Katharine F. Bowes

A triclinic polymorph of benzanilide: disordered molecules form hydrogen-bonded chains

In the P-1 polymorph of benzanilide or N-phenylbenzamide, C(13)H(11)NO, the molecules are linked into simple C(4) chains by N-H...O hydrogen bonds. The molecules exhibit orientational disorder, but the donor and acceptor in a given hydrogen bond may occur, independently, in either the major or the minor orientation, such that all four possible N-H.O combinations have very similar geometries. The structure of this P-1 polymorph can be related to that of a previously reported C2/c polymorph.

4,4'-Trimethylenedipyridinium bis[carboxymethylphosphonate(1-)]: a three-dimensional framework structure built from O-H...O, N-H...O and C-H...O hydrogen bonds.

In the title compound, C(13)H(16)N(2)(2+).2C(2)H(4)O(5)P(-), the cation lies across a twofold rotation axis in space group Fdd2. The anions are linked into molecular ladders by two O-H.O hydrogen bonds [H.O = 1.73 and 1.77 A, O.O = 2.538 (2) and 2.598 (3) A, and O-H.O = 160 and 170 degrees ], these ladders are linked into sheets by a single type of N-H.O hydrogen bond [H.O = 1.75 A, N.O = 2.624 (3) A and N-H.O = 171 degrees ] and the sheets are linked into a three-dimensional framework by a single type of C-H.O hydrogen bond [H.O = 2.48 A, C.O = 3.419 (4) A and C-H.O = 167 degrees ].

meso-5,5,7,12,12,14-Hexamethyl-1,4-diaza-8,11-diazoniacyclotetradecane bis(2-naphthoate) ethanol disolvate: centrosymmetric five-component aggregates linked into sheets by C-H...π(arene) hydrogen bonding

The title compound is an ethanol-solvated salt, C(16)H(38)N(4)(2+) x -2C(11)H(7)O(2)(-) x -2C(2)H(6)O, in which the cation lies across a centre of inversion in P2(1)/c. The ions are linked by N-H...O hydrogen bonds [H...O = 1.70 and 2.30 A, N...O = 2.624 (2) and 3.136 (2) A, and N-H...O = 178 and 151 degrees ], and the ethanol molecule is linked to the anion by an O-H...O hydrogen bond [H...O = 1.90 A, O...O = 2.728 (2) A and O-H...O = 171 degrees ], to form a centrosymmetric five-component aggregate. C-H...O hydrogen bonds and aromatic pi-pi-stacking interactions are absent, but the aggregates are linked into sheets by a single C-H...pi(arene) hydrogen bond.

meso-5,5,7,12,12,14-Hexamethyl-4,11-diaza-1,8-diazoniacyclotetradecane (S)-malate(2-) methanol disolvate: a chain of rings generated by two pairs of N-H...O hydrogen bonds

The title compound is a methanol-solvated salt, C(16)H(38)N(4)(2+).C(4)H(4)O(5)(2-).2CH(3)OH, in which the ionic components are linked into chains by two pairs of N-H.O hydrogen bonds [H.O = 1.78-2.21 A, N.O = 2.702 (14)-3.094 (8) A and N-H.O = 160-179 degrees ]. The methanol molecules are pendent from the chain and are linked to it by O-H.O hydrogen bonds [H.O = 1.86 and 1.89 A, O.O = 2.691 (9) and 2.708 (16) A, and O-H.O = 168 and 165 degrees ].

1,4,8,11-Tetraazoniacyclotetradecane tetrakis(phenylphosphonate) dihydrate forms hydrogen-bonded sheets.

In the title compound, C(10)H(28)N(4)(4+).4C(6)H(6)O(3)P(-).2H(2)O, the cation lies across a centre of inversion in space group P2(1)/n. The two independent anions and the water molecule are linked by four O-H.O hydrogen bonds [H.O = 1.74-2.15 (3) A, O.O = 2.5482 (14)-3.0438 (16) A and O-H.O = 160-176 (2) degrees ] into sheets containing equal numbers of centrosymmetric R(6)(6)(16) and R(10)(10)(36) rings. The cation lies at the centre of the R(10)(10)(36) ring and is linked to it by eight N-H.O hydrogen bonds [H.O = 1.77-1.98 A, N.O = 2.6756 (15)-2.8168 (16) A and N-H.O = 151-169 degrees ].

Self-assembled hydrogen-bonded bilayers in 1,4-diazabicyclo[2.2.2]octane–N-(phosphonomethyl)iminodiacetic acid–water (1/1/1.5)

The title compound is a hydrated salt, 1,4-diazoniabicyclo[2.2.2]octane-N-[(hydroxyphosphinato)methyl]iminiodiacetate-water (1/1/1.5), C(6)H(14)N(2)(2+).C(5)H(8)NO(7)P(2-).1.5H(2)O, in which one of the water molecules lies across a twofold rotation axis in space group P2/n. The ionic components are linked into sheets by a combination of a three-centre N-H...(O)(2) hydrogen bond and two-centre O-H...O and N-H...O hydrogen bonds, and these sheets are pairwise linked by the water molecules into bilayers, by means of further O-H...O hydrogen bonds.